Hướng dẫn how do you make a histogram line in python? - làm thế nào để bạn tạo một dòng biểu đồ trong python?

Biểu đồ trong Python thuần túy

Khi bạn đang chuẩn bị vẽ một biểu đồ, việc không nghĩ về các thùng là đơn giản nhất mà là báo cáo bao nhiêu lần mỗi giá trị xuất hiện (một bảng tần số). Một từ điển Python rất phù hợp cho nhiệm vụ này:

>>>

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

Trên thực tế, đây chính xác là những gì được thực hiện bởi lớp

import numpy as np
import matplotlib.mlab as mlab
import matplotlib.pyplot as plt

mu = 0
sigma = 1
noise = np.random.normal(mu, sigma, size=1000)
num_bins = 7
n, bins, _ = plt.hist(noise, num_bins, normed=1, histtype='step')
y = mlab.normpdf(bins, mu, sigma)
plt.plot(bins, y, 'r--')
plt.show()

import numpy as np
import matplotlib.mlab as mlab
import matplotlib.pyplot as plt

mu = 0
sigma = 1
noise = np.random.normal(mu, sigma, size=1000)
num_bins = 7
n, bins, _ = plt.hist(noise, num_bins, normed=1, histtype='step')
y = mlab.normpdf(bins, mu, sigma)
plt.plot(bins, y, 'r--')
plt.show()

>>>

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

>>>

>>> recounted.items() == counted.items()
True

Nó có thể hữu ích để xây dựng các chức năng đơn giản hóa từ đầu như là bước đầu tiên để hiểu các chức năng phức tạp hơn. Hãy để tiếp tục phát minh lại bánh xe một chút với biểu đồ ASCII tận dụng định dạng đầu ra của Python,:

def ascii_histogram(seq) -> None:
    """A horizontal frequency-table/histogram plot."""
    counted = count_elements(seq)
    for k in sorted(counted):
        print('{0:5d} {1}'.format(k, '+' * counted[k]))

Hàm này tạo ra một biểu đồ tần số được sắp xếp trong đó số lượng được biểu diễn dưới dạng các biểu tượng của Plus (

import numpy as np
import matplotlib.mlab as mlab
import matplotlib.pyplot as plt

mu = 0
sigma = 1
noise = np.random.normal(mu, sigma, size=1000)
num_bins = 7
n, bins, _ = plt.hist(noise, num_bins, normed=1, histtype='step')
y = mlab.normpdf(bins, mu, sigma)
plt.plot(bins, y, 'r--')
plt.show()

import numpy as np
import matplotlib.mlab as mlab
import matplotlib.pyplot as plt

mu = 0
sigma = 1
noise = np.random.normal(mu, sigma, size=1000)
num_bins = 7
n, bins, _ = plt.hist(noise, num_bins, normed=1, histtype='step')
y = mlab.normpdf(bins, mu, sigma)
plt.plot(bins, y, 'r--')
plt.show()

import numpy as np
import matplotlib.mlab as mlab
import matplotlib.pyplot as plt

mu = 0
sigma = 1
noise = np.random.normal(mu, sigma, size=1000)
num_bins = 7
n, bins, _ = plt.hist(noise, num_bins, normed=1, histtype='step')
y = mlab.normpdf(bins, mu, sigma)
plt.plot(bins, y, 'r--')
plt.show()

>>>

>>> # No NumPy ... yet
>>> import random
>>> random.seed(1)

>>> vals = [1, 3, 4, 6, 8, 9, 10]
>>> # Each number in `vals` will occur between 5 and 15 times.
>>> freq = (random.randint(5, 15) for _ in vals)

>>> data = []
>>> for f, v in zip(freq, vals):
...     data.extend([v] * f)

>>> ascii_histogram(data)
    1 +++++++
    3 ++++++++++++++
    4 ++++++
    6 +++++++++
    8 ++++++
    9 ++++++++++++
   10 ++++++++++++

Ở đây, bạn có thể mô phỏng việc nhổ lông từ

import numpy as np
import matplotlib.mlab as mlab
import matplotlib.pyplot as plt

mu = 0
sigma = 1
noise = np.random.normal(mu, sigma, size=1000)
num_bins = 7
n, bins, _ = plt.hist(noise, num_bins, normed=1, histtype='step')
y = mlab.normpdf(bins, mu, sigma)
plt.plot(bins, y, 'r--')
plt.show()

import numpy as np
import matplotlib.mlab as mlab
import matplotlib.pyplot as plt

mu = 0
sigma = 1
noise = np.random.normal(mu, sigma, size=1000)
num_bins = 7
n, bins, _ = plt.hist(noise, num_bins, normed=1, histtype='step')
y = mlab.normpdf(bins, mu, sigma)
plt.plot(bins, y, 'r--')
plt.show()

import numpy as np
import matplotlib.mlab as mlab
import matplotlib.pyplot as plt

mu = 0
sigma = 1
noise = np.random.normal(mu, sigma, size=1000)
num_bins = 7
n, bins, _ = plt.hist(noise, num_bins, normed=1, histtype='step')
y = mlab.normpdf(bins, mu, sigma)
plt.plot(bins, y, 'r--')
plt.show()

Xây dựng từ cơ sở: Tính toán biểu đồ trong Numpy

Cho đến nay, bạn đã làm việc với những gì có thể được gọi là bảng tần số tốt nhất. Nhưng về mặt toán học, một biểu đồ là một ánh xạ các thùng (khoảng) đến tần số. Về mặt kỹ thuật, nó có thể được sử dụng để xấp xỉ hàm mật độ xác suất (PDF) của biến cơ bản.

Di chuyển từ bảng tần số của người Viking ở trên, một biểu đồ thực sự đầu tiên là các thùng rác, phạm vi của các giá trị và sau đó đếm số lượng các giá trị rơi vào mỗi thùng. Đây là những gì chức năng Numpy từ

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

Hãy xem xét một mẫu phao được rút ra từ phân phối Laplace. Phân phối này có đuôi béo hơn so với phân phối bình thường và có hai tham số mô tả (vị trí và tỷ lệ):

>>>

>>> import numpy as np
>>> # `numpy.random` uses its own PRNG.
>>> np.random.seed(444)
>>> np.set_printoptions(precision=3)

>>> d = np.random.laplace(loc=15, scale=3, size=500)
>>> d[:5]
array([18.406, 18.087, 16.004, 16.221,  7.358])

Trong trường hợp này, bạn đã làm việc với một phân phối liên tục, và nó sẽ rất hữu ích khi kiểm đếm từng chiếc phao một cách độc lập, xuống vị trí thập phân. Thay vào đó, bạn có thể thùng hoặc xô của người dùng dữ liệu và đếm các quan sát rơi vào mỗi thùng. Biểu đồ là số lượng kết quả của các giá trị trong mỗi thùng:

>>>

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

Kết quả này có thể không trực quan ngay lập tức.

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

>>>

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

Một sự cố rất cô đọng về cách các thùng được xây dựng bởi Numpy trông như thế này:

>>>

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

Trường hợp trên có rất nhiều ý nghĩa: 10 thùng cách đều nhau trong phạm vi từ cực đại đến đỉnh của 23 khoảng thời gian có chiều rộng 2.3.

Từ đó, chức năng ủy quyền cho

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

>>>

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

Hình dung biểu đồ với matplotlib và gấu trúc

Bây giờ, bạn đã thấy cách xây dựng một biểu đồ trong Python từ đầu, hãy để xem các gói Python khác có thể thực hiện công việc cho bạn như thế nào. Matplotlib cung cấp chức năng để trực quan hóa biểu đồ python ra khỏi hộp với một trình bao bọc đa năng xung quanh Numpy tựa

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

Như đã định nghĩa trước đó, một biểu đồ của biểu đồ sử dụng các cạnh bin của nó trên trục x và tần số tương ứng trên trục y. Trong biểu đồ trên, việc vượt qua

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

Ở trong ngăn xếp khoa học của Python, Pandas,

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

Sơ đồ ước tính mật độ hạt nhân (KDE)

Trong hướng dẫn này, bạn đã làm việc với các mẫu, nói về mặt thống kê. Cho dù dữ liệu là rời rạc hay liên tục, nó được cho là có nguồn gốc từ một dân số có phân phối chính xác, chính xác được mô tả chỉ bằng một vài tham số.

Ước tính mật độ kernel (KDE) là một cách để ước tính hàm mật độ xác suất (PDF) của biến ngẫu nhiên mà cách làm nền tảng cho mẫu của chúng tôi. KDE là một phương tiện làm mịn dữ liệu.

Gắn bó với thư viện PANDAS, bạn có thể tạo và phủ các sơ đồ mật độ bằng cách sử dụng

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

>>>

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

Bây giờ, để vẽ từng biểu đồ trên cùng một trục matplotlib:

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

Các phương pháp này tận dụng SCIPY từ

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

Nếu bạn xem xét kỹ hơn chức năng này, bạn có thể thấy nó gần đúng mức độ của PDF True True PDF đối với một mẫu tương đối nhỏ gồm 1000 điểm dữ liệu. Dưới đây, trước tiên bạn có thể xây dựng phân phối phân tích trực tuyến với

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

Xây dựng từ đó, bạn có thể lấy một mẫu ngẫu nhiên là 1000 datapoints từ phân phối này, sau đó cố gắng quay lại ước tính PDF với

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

Đây là một đoạn mã lớn hơn, vì vậy, hãy để một giây để chạm vào một vài dòng chính:

• Subpackage SCIPY từ

  >>> from collections import Counter
  
  >>> recounted = Counter(a)
  >>> recounted
  Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})
  

  7 cho phép bạn tạo các đối tượng Python đại diện cho các phân phối phân tích mà bạn có thể lấy mẫu để tạo dữ liệu thực tế. Vì vậy,

  >>> from collections import Counter
  
  >>> recounted = Counter(a)
  >>> recounted
  Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})
  

  8 đại diện cho một biến ngẫu nhiên liên tục thông thường và bạn tạo ra các số ngẫu nhiên từ nó với

  >>> from collections import Counter
  
  >>> recounted = Counter(a)
  >>> recounted
  Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})
  

  9.
• Để đánh giá cả PDF phân tích và KDE Gaussian, bạn cần một mảng

  >>> recounted.items() == counted.items()
  True
  

  0 lượng tử (độ lệch chuẩn ở trên/dưới giá trị trung bình, cho phân phối bình thường).

  >>> recounted.items() == counted.items()
  True
  

  1 đại diện cho một PDF ước tính mà bạn cần đánh giá trên một mảng để tạo ra một cái gì đó có ý nghĩa trực quan trong trường hợp này.
• Dòng cuối cùng chứa một số latex, tích hợp độc đáo với matplotlib.

Một sự thay thế lạ mắt với Seaborn

Hãy để Lừa mang thêm một gói Python vào hỗn hợp. Seaborn có chức năng

>>> recounted.items() == counted.items()
True

>>> recounted.items() == counted.items()
True

import matplotlib.pyplot as plt
import numpy as np
import scipy.stats as stats

noise = np.random.normal(0, 1, (1000, ))
density = stats.gaussian_kde(noise)
n, x, _ = plt.hist(noise, bins=np.linspace(-3, 3, 50), 
                   histtype=u'step', density=True)  
plt.plot(x, density(x))
plt.show()

Cuộc gọi ở trên tạo ra một KDE. Ngoài ra còn có tính tùy chọn để phù hợp với một phân phối cụ thể cho dữ liệu. Điều này khác với KDE và bao gồm ước tính tham số cho dữ liệu chung và tên phân phối được chỉ định:

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

Một lần nữa, lưu ý sự khác biệt nhỏ. Trong trường hợp đầu tiên, bạn đã ước tính một số PDF không xác định; Trong lần thứ hai, bạn đã lấy một phân phối đã biết và tìm ra những tham số mô tả tốt nhất nó được cung cấp dữ liệu thực nghiệm.

Các công cụ khác trong gấu trúc

Ngoài các công cụ âm mưu của nó, Pandas cũng cung cấp một phương thức

>>> recounted.items() == counted.items()
True

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

>>>

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

Ở những nơi khác,

>>> recounted.items() == counted.items()
True

>>>

noise = np.random.normal(0,1,(1000,1))
n,x,_ = plt.hist(noise, bins = np.linspace(-3,3,7), histtype=u'step' )
bin_centers = 0.5*(x[1:]+x[:-1])
plt.plot(bin_centers,n) ## using bin_centers rather than edges
plt.show()

Ở những nơi khác,

>>> recounted.items() == counted.items()
True

Điều mà tốt đẹp là cả hai hoạt động này cuối cùng sử dụng mã Cython giúp chúng cạnh tranh về tốc độ trong khi duy trì tính linh hoạt của chúng.

Được rồi, vậy tôi nên sử dụng cái nào?

>>> recounted.items() == counted.items()
True

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

def ascii_histogram(seq) -> None:
    """A horizontal frequency-table/histogram plot."""
    counted = count_elements(seq)
    for k in sorted(counted):
        print('{0:5d} {1}'.format(k, '+' * counted[k]))

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

>>> from collections import Counter

>>> recounted = Counter(a)
>>> recounted
Counter({0: 1, 1: 3, 3: 1, 2: 1, 7: 2, 23: 1})

def ascii_histogram(seq) -> None:
    """A horizontal frequency-table/histogram plot."""
    counted = count_elements(seq)
    for k in sorted(counted):
        print('{0:5d} {1}'.format(k, '+' * counted[k]))

def ascii_histogram(seq) -> None:
    """A horizontal frequency-table/histogram plot."""
    counted = count_elements(seq)
    for k in sorted(counted):
        print('{0:5d} {1}'.format(k, '+' * counted[k]))

def ascii_histogram(seq) -> None:
    """A horizontal frequency-table/histogram plot."""
    counted = count_elements(seq)
    for k in sorted(counted):
        print('{0:5d} {1}'.format(k, '+' * counted[k]))

def ascii_histogram(seq) -> None:
    """A horizontal frequency-table/histogram plot."""
    counted = count_elements(seq)
    for k in sorted(counted):
        print('{0:5d} {1}'.format(k, '+' * counted[k]))

def ascii_histogram(seq) -> None:
    """A horizontal frequency-table/histogram plot."""
    counted = count_elements(seq)
    for k in sorted(counted):
        print('{0:5d} {1}'.format(k, '+' * counted[k]))

def ascii_histogram(seq) -> None:
    """A horizontal frequency-table/histogram plot."""
    counted = count_elements(seq)
    for k in sorted(counted):
        print('{0:5d} {1}'.format(k, '+' * counted[k]))

def ascii_histogram(seq) -> None:
    """A horizontal frequency-table/histogram plot."""
    counted = count_elements(seq)
    for k in sorted(counted):
        print('{0:5d} {1}'.format(k, '+' * counted[k]))

>>> # Need not be sorted, necessarily
>>> a = (0, 1, 1, 1, 2, 3, 7, 7, 23)

>>> def count_elements(seq) -> dict:
...     """Tally elements from `seq`."""
...     hist = {}
...     for i in seq:
...         hist[i] = hist.get(i, 0) + 1
...     return hist

>>> counted = count_elements(a)
>>> counted
{0: 1, 1: 3, 2: 1, 3: 1, 7: 2, 23: 1}

>>> # No NumPy ... yet
>>> import random
>>> random.seed(1)

>>> vals = [1, 3, 4, 6, 8, 9, 10]
>>> # Each number in `vals` will occur between 5 and 15 times.
>>> freq = (random.randint(5, 15) for _ in vals)

>>> data = []
>>> for f, v in zip(freq, vals):
...     data.extend([v] * f)

>>> ascii_histogram(data)
    1 +++++++
    3 ++++++++++++++
    4 ++++++
    6 +++++++++
    8 ++++++
    9 ++++++++++++
   10 ++++++++++++

Bạn cũng có thể tìm thấy các đoạn mã từ bài viết này cùng nhau trong một tập lệnh tại trang Vật liệu Python thực.

Với điều đó, chúc may mắn tạo ra biểu đồ trong tự nhiên. Hy vọng một trong những công cụ trên sẽ phù hợp với nhu cầu của bạn. Dù bạn làm gì, chỉ cần don sử dụng biểu đồ hình tròn.